About (E)-2,3-diamino-3-[2-amino-3-(5-chloro-2-hydroxyphenyl)phenyl]-N-propylprop-2-enamide
(E)-2,3-diamino-3-[2-amino-3-(5-chloro-2-hydroxyphenyl)phenyl]-N-propylprop-2-enamide (PubChem CID 143493520) has the molecular formula C18H21ClN4O2
and a molecular weight of 360.85 g/mol. Its IUPAC name is (E)-2,3-diamino-3-[2-amino-3-(5-chloro-2-hydroxyphenyl)phenyl]-N-propylprop-2-enamide.
Molecular Properties
| Compound Name | (E)-2,3-diamino-3-[2-amino-3-(5-chloro-2-hydroxyphenyl)phenyl]-N-propylprop-2-enamide |
| PubChem CID | 143493520 |
| Molecular Formula | C18H21ClN4O2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (E)-2,3-diamino-3-[2-amino-3-(5-chloro-2-hydroxyphenyl)phenyl]-N-propylprop-2-enamide |
| SMILES | CCCNC(=O)/C(N)=C(\N)c1cccc(-c2cc(Cl)ccc2O)c1N |
| InChI | InChI=1S/C18H21ClN4O2/c1-2-8-23-18(25)17(22)16(21)12-5-3-4-11(15(12)20)13-9-10(19)6-7-14(13)24/h3-7,9,24H,2,8,20-22H2,1H3,(H,23,25)/b17-16+ |
| InChIKey | JGMQTORDEQXKKB-WUKNDPDISA-N |
| XLogP | 2.41 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,3-diamino-3-[2-amino-3-(5-chloro-2-hydroxyphenyl)phenyl]-N-propylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3-diamino-3-[2-amino-3-(5-chloro-2-hydroxyphenyl)phenyl]-N-propylprop-2-enamide?
The IUPAC name of (E)-2,3-diamino-3-[2-amino-3-(5-chloro-2-hydroxyphenyl)phenyl]-N-propylprop-2-enamide (CID 143493520) is (E)-2,3-diamino-3-[2-amino-3-(5-chloro-2-hydroxyphenyl)phenyl]-N-propylprop-2-enamide.
What is the SMILES notation for (E)-2,3-diamino-3-[2-amino-3-(5-chloro-2-hydroxyphenyl)phenyl]-N-propylprop-2-enamide?
The canonical SMILES for (E)-2,3-diamino-3-[2-amino-3-(5-chloro-2-hydroxyphenyl)phenyl]-N-propylprop-2-enamide is CCCNC(=O)/C(N)=C(\N)c1cccc(-c2cc(Cl)ccc2O)c1N.
What is the InChIKey of (E)-2,3-diamino-3-[2-amino-3-(5-chloro-2-hydroxyphenyl)phenyl]-N-propylprop-2-enamide?
The InChIKey is JGMQTORDEQXKKB-WUKNDPDISA-N. The full InChI is InChI=1S/C18H21ClN4O2/c1-2-8-23-18(25)17(22)16(21)12-5-3-4-11(15(12)20)13-9-10(19)6-7-14(13)24/h3-7,9,24H,2,8,20-22H2,1H3,(H,23,25)/b17-16+.
What are the key properties of (E)-2,3-diamino-3-[2-amino-3-(5-chloro-2-hydroxyphenyl)phenyl]-N-propylprop-2-enamide?
(E)-2,3-diamino-3-[2-amino-3-(5-chloro-2-hydroxyphenyl)phenyl]-N-propylprop-2-enamide has a molecular weight of 360.85 g/mol, XLogP of 2.41, 5 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-diamino-3-[2-amino-3-(5-chloro-2-hydroxyphenyl)phenyl]-N-propylprop-2-enamide is sourced from PubChem (CID 143493520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).