C19H21FN4O — CID 89354995
(E)-3-amino-3-[2-amino-3-(4-fluorophenyl)phenyl]-2-(methylideneamino)-N-propylprop-2-enamide (PubChem CID 89354995) has the molecular formula C19H21FN4O and a molecular weight of 340.40 g/mol. Its IUPAC name is (E)-3-amino-3-[2-amino-3-(4-fluorophenyl)phenyl]-2-(methylideneamino)-N-propylprop-2-enamide.
| Compound Name | (E)-3-amino-3-[2-amino-3-(4-fluorophenyl)phenyl]-2-(methylideneamino)-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 89354995 |
| Molecular Formula | C19H21FN4O |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (E)-3-amino-3-[2-amino-3-(4-fluorophenyl)phenyl]-2-(methylideneamino)-N-propylprop-2-enamide |
| SMILES | C=N/C(C(=O)NCCC)=C(/N)c1cccc(-c2ccc(F)cc2)c1N |
| InChI | InChI=1S/C19H21FN4O/c1-3-11-24-19(25)18(23-2)17(22)15-6-4-5-14(16(15)21)12-7-9-13(20)10-8-12/h4-10H,2-3,11,21-22H2,1H3,(H,24,25)/b18-17+ |
| InChIKey | UDGKHMXIHMCRLK-ISLYRVAYSA-N |
| XLogP | 2.93 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|