C18H22ClN5O2 — CID 143493545
(E)-2,3-diamino-3-[2-amino-3-(5-chloro-6-methoxy-3-pyridinyl)phenyl]-N-propylprop-2-enamide (PubChem CID 143493545) has the molecular formula C18H22ClN5O2 and a molecular weight of 375.86 g/mol. Its IUPAC name is (E)-2,3-diamino-3-[2-amino-3-(5-chloro-6-methoxy-3-pyridinyl)phenyl]-N-propylprop-2-enamide.
| Compound Name | (E)-2,3-diamino-3-[2-amino-3-(5-chloro-6-methoxy-3-pyridinyl)phenyl]-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 143493545 |
| Molecular Formula | C18H22ClN5O2 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (E)-2,3-diamino-3-[2-amino-3-(5-chloro-6-methoxy-3-pyridinyl)phenyl]-N-propylprop-2-enamide |
| SMILES | CCCNC(=O)/C(N)=C(\N)c1cccc(-c2cnc(OC)c(Cl)c2)c1N |
| InChI | InChI=1S/C18H22ClN5O2/c1-3-7-23-17(25)16(22)15(21)12-6-4-5-11(14(12)20)10-8-13(19)18(26-2)24-9-10/h4-6,8-9H,3,7,20-22H2,1-2H3,(H,23,25)/b16-15+ |
| InChIKey | MRROWTCAXMRJPA-FOCLMDBBSA-N |
| XLogP | 2.11 |
| TPSA | 129.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|