C20H25FN4O — CID 143493499
(E)-2,3-diamino-3-[2-amino-3-(2,3-dimethylphenyl)-4-fluorophenyl]-N-propylprop-2-enamide (PubChem CID 143493499) has the molecular formula C20H25FN4O and a molecular weight of 356.45 g/mol. Its IUPAC name is (E)-2,3-diamino-3-[2-amino-3-(2,3-dimethylphenyl)-4-fluorophenyl]-N-propylprop-2-enamide.
| Compound Name | (E)-2,3-diamino-3-[2-amino-3-(2,3-dimethylphenyl)-4-fluorophenyl]-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 143493499 |
| Molecular Formula | C20H25FN4O |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (E)-2,3-diamino-3-[2-amino-3-(2,3-dimethylphenyl)-4-fluorophenyl]-N-propylprop-2-enamide |
| SMILES | CCCNC(=O)/C(N)=C(\N)c1ccc(F)c(-c2cccc(C)c2C)c1N |
| InChI | InChI=1S/C20H25FN4O/c1-4-10-25-20(26)19(24)18(23)14-8-9-15(21)16(17(14)22)13-7-5-6-11(2)12(13)3/h5-9H,4,10,22-24H2,1-3H3,(H,25,26)/b19-18+ |
| InChIKey | RXXUZVMERJCBRO-VHEBQXMUSA-N |
| XLogP | 2.80 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|