C19H23FN4O — CID 143493515
(E)-2,3-diamino-3-[2-amino-3-(2-fluoro-5-methylphenyl)phenyl]-N-propylprop-2-enamide (PubChem CID 143493515) has the molecular formula C19H23FN4O and a molecular weight of 342.42 g/mol. Its IUPAC name is (E)-2,3-diamino-3-[2-amino-3-(2-fluoro-5-methylphenyl)phenyl]-N-propylprop-2-enamide.
| Compound Name | (E)-2,3-diamino-3-[2-amino-3-(2-fluoro-5-methylphenyl)phenyl]-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 143493515 |
| Molecular Formula | C19H23FN4O |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (E)-2,3-diamino-3-[2-amino-3-(2-fluoro-5-methylphenyl)phenyl]-N-propylprop-2-enamide |
| SMILES | CCCNC(=O)/C(N)=C(\N)c1cccc(-c2cc(C)ccc2F)c1N |
| InChI | InChI=1S/C19H23FN4O/c1-3-9-24-19(25)18(23)17(22)13-6-4-5-12(16(13)21)14-10-11(2)7-8-15(14)20/h4-8,10H,3,9,21-23H2,1-2H3,(H,24,25)/b18-17+ |
| InChIKey | XUUXCYDITMTDOK-ISLYRVAYSA-N |
| XLogP | 2.50 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|