C20H29N5O — CID 143493621
(E)-2,3-diamino-3-[2-(methylamino)-3-(4-methyl-3,4-dihydro-2H-azepin-6-yl)phenyl]-N-propylprop-2-enamide (PubChem CID 143493621) has the molecular formula C20H29N5O and a molecular weight of 355.49 g/mol. Its IUPAC name is (E)-2,3-diamino-3-[2-(methylamino)-3-(4-methyl-3,4-dihydro-2H-azepin-6-yl)phenyl]-N-propylprop-2-enamide.
| Compound Name | (E)-2,3-diamino-3-[2-(methylamino)-3-(4-methyl-3,4-dihydro-2H-azepin-6-yl)phenyl]-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 143493621 |
| Molecular Formula | C20H29N5O |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | (E)-2,3-diamino-3-[2-(methylamino)-3-(4-methyl-3,4-dihydro-2H-azepin-6-yl)phenyl]-N-propylprop-2-enamide |
| SMILES | CCCNC(=O)/C(N)=C(\N)c1cccc(C2=CC(C)CCN=C2)c1NC |
| InChI | InChI=1S/C20H29N5O/c1-4-9-25-20(26)18(22)17(21)16-7-5-6-15(19(16)23-3)14-11-13(2)8-10-24-12-14/h5-7,11-13,23H,4,8-10,21-22H2,1-3H3,(H,25,26)/b18-17+ |
| InChIKey | OXADIRMYELBDMM-ISLYRVAYSA-N |
| XLogP | 2.33 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|