C25H28ClFN4O — CID 166929444
(2Z,4Z)-N-[(2R)-butan-2-yl]-3-[[2-(5-chloro-2-fluorophenyl)-5-prop-1-en-2-yl-4-pyridinyl]amino]-2-methyl-5-(methylideneamino)penta-2,4-dienamide (PubChem CID 166929444) has the molecular formula C25H28ClFN4O and a molecular weight of 454.98 g/mol. Its IUPAC name is (2Z,4Z)-N-[(2R)-butan-2-yl]-3-[[2-(5-chloro-2-fluorophenyl)-5-prop-1-en-2-yl-4-pyridinyl]amino]-2-methyl-5-(methylideneamino)penta-2,4-dienamide.
| Compound Name | (2Z,4Z)-N-[(2R)-butan-2-yl]-3-[[2-(5-chloro-2-fluorophenyl)-5-prop-1-en-2-yl-4-pyridinyl]amino]-2-methyl-5-(methylideneamino)penta-2,4-dienamide |
|---|---|
| PubChem CID | 166929444 |
| Molecular Formula | C25H28ClFN4O |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | (2Z,4Z)-N-[(2R)-butan-2-yl]-3-[[2-(5-chloro-2-fluorophenyl)-5-prop-1-en-2-yl-4-pyridinyl]amino]-2-methyl-5-(methylideneamino)penta-2,4-dienamide |
| SMILES | C=N/C=C\C(Nc1cc(-c2cc(Cl)ccc2F)ncc1C(=C)C)=C(/C)C(=O)N[C@H](C)CC |
| InChI | InChI=1S/C25H28ClFN4O/c1-7-16(4)30-25(32)17(5)22(10-11-28-6)31-24-13-23(29-14-20(24)15(2)3)19-12-18(26)8-9-21(19)27/h8-14,16H,2,6-7H2,1,3-5H3,(H,29,31)(H,30,32)/b11-10-,22-17-/t16-/m1/s1 |
| InChIKey | FLCOGFYJHLCWDK-XDBYNKIFSA-N |
| XLogP | 6.39 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|