C28H25Cl2N5O2 — CID 140893010
4-[[4-[(E)-2-[5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-1H-indazol-3-yl]ethenyl]-3-isocyanophenyl]methyl]morpholine (PubChem CID 140893010) has the molecular formula C28H25Cl2N5O2 and a molecular weight of 534.45 g/mol. Its IUPAC name is 4-[[4-[(E)-2-[5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-1H-indazol-3-yl]ethenyl]-3-isocyanophenyl]methyl]morpholine.
| Compound Name | 4-[[4-[(E)-2-[5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-1H-indazol-3-yl]ethenyl]-3-isocyanophenyl]methyl]morpholine |
|---|---|
| PubChem CID | 140893010 |
| Molecular Formula | C28H25Cl2N5O2 |
| Molecular Weight | 534.45 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | 4-[[4-[(E)-2-[5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-1H-indazol-3-yl]ethenyl]-3-isocyanophenyl]methyl]morpholine |
| SMILES | [C-]#[N+]c1cc(CN2CCOCC2)ccc1/C=C/c1n[nH]c2ccc(OC(C)c3c(Cl)cncc3Cl)cc12 |
| InChI | InChI=1S/C28H25Cl2N5O2/c1-18(28-23(29)15-32-16-24(28)30)37-21-6-8-26-22(14-21)25(33-34-26)7-5-20-4-3-19(13-27(20)31-2)17-35-9-11-36-12-10-35/h3-8,13-16,18H,9-12,17H2,1H3,(H,33,34)/b7-5+ |
| InChIKey | RUYIIXJGTIGNLT-FNORWQNLSA-N |
| XLogP | 6.96 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.45 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|