C26H25Cl2N5O3 — CID 145256592
(Z)-1-[5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-1H-indazol-3-yl]-2-[6-(morpholin-4-ylmethyl)-3-pyridinyl]ethenol (PubChem CID 145256592) has the molecular formula C26H25Cl2N5O3 and a molecular weight of 526.42 g/mol. Its IUPAC name is (Z)-1-[5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-1H-indazol-3-yl]-2-[6-(morpholin-4-ylmethyl)-3-pyridinyl]ethenol.
| Compound Name | (Z)-1-[5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-1H-indazol-3-yl]-2-[6-(morpholin-4-ylmethyl)-3-pyridinyl]ethenol |
|---|---|
| PubChem CID | 145256592 |
| Molecular Formula | C26H25Cl2N5O3 |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | (Z)-1-[5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-1H-indazol-3-yl]-2-[6-(morpholin-4-ylmethyl)-3-pyridinyl]ethenol |
| SMILES | CC(Oc1ccc2[nH]nc(/C(O)=C/c3ccc(CN4CCOCC4)nc3)c2c1)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C26H25Cl2N5O3/c1-16(25-21(27)13-29-14-22(25)28)36-19-4-5-23-20(11-19)26(32-31-23)24(34)10-17-2-3-18(30-12-17)15-33-6-8-35-9-7-33/h2-5,10-14,16,34H,6-9,15H2,1H3,(H,31,32)/b24-10- |
| InChIKey | QXLRGGKBSLJXJU-VROXFSQNSA-N |
| XLogP | 5.69 |
| TPSA | 96.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|