C23H13F9N2O4 — CID 140896239
[4-[4-amino-2-(trifluoromethyl)benzoyl]oxy-2-(trifluoromethyl)phenyl] 4-amino-3-(trifluoromethyl)benzoate (PubChem CID 140896239) has the molecular formula C23H13F9N2O4 and a molecular weight of 552.35 g/mol. Its IUPAC name is [4-[4-amino-2-(trifluoromethyl)benzoyl]oxy-2-(trifluoromethyl)phenyl] 4-amino-3-(trifluoromethyl)benzoate.
| Compound Name | [4-[4-amino-2-(trifluoromethyl)benzoyl]oxy-2-(trifluoromethyl)phenyl] 4-amino-3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 140896239 |
| Molecular Formula | C23H13F9N2O4 |
| Molecular Weight | 552.35 g/mol |
| Exact Mass | 552.07 |
| IUPAC Name | [4-[4-amino-2-(trifluoromethyl)benzoyl]oxy-2-(trifluoromethyl)phenyl] 4-amino-3-(trifluoromethyl)benzoate |
| SMILES | Nc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(N)c(C(F)(F)F)c3)c(C(F)(F)F)c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H13F9N2O4/c24-21(25,26)14-8-11(33)2-4-13(14)20(36)37-12-3-6-18(16(9-12)23(30,31)32)38-19(35)10-1-5-17(34)15(7-10)22(27,28)29/h1-9H,33-34H2 |
| InChIKey | RSZFTUJQIILYBH-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.35 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|