C17H13BrFN3O4S — CID 140896915
(5Z)-5-[[2-bromo-3-fluoro-4-hydroxy-5-[(2-methylpyrimidin-5-yl)methoxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione (PubChem CID 140896915) has the molecular formula C17H13BrFN3O4S and a molecular weight of 454.28 g/mol. Its IUPAC name is (5Z)-5-[[2-bromo-3-fluoro-4-hydroxy-5-[(2-methylpyrimidin-5-yl)methoxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-bromo-3-fluoro-4-hydroxy-5-[(2-methylpyrimidin-5-yl)methoxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 140896915 |
| Molecular Formula | C17H13BrFN3O4S |
| Molecular Weight | 454.28 g/mol |
| Exact Mass | 452.98 |
| IUPAC Name | (5Z)-5-[[2-bromo-3-fluoro-4-hydroxy-5-[(2-methylpyrimidin-5-yl)methoxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ncc(COc2cc(/C=C3\SC(=O)N(C)C3=O)c(Br)c(F)c2O)cn1 |
| InChI | InChI=1S/C17H13BrFN3O4S/c1-8-20-5-9(6-21-8)7-26-11-3-10(13(18)14(19)15(11)23)4-12-16(24)22(2)17(25)27-12/h3-6,23H,7H2,1-2H3/b12-4- |
| InChIKey | WNCDZEGMGADDQW-QCDXTXTGSA-N |
| XLogP | 3.64 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|