C13H13NO4S — CID 140897181
(5Z)-5-[(4-hydroxy-5-methoxy-2-methylphenyl)methylidene]-3-methyl-1,3-thiazolidine-2,4-dione (PubChem CID 140897181) has the molecular formula C13H13NO4S and a molecular weight of 279.32 g/mol. Its IUPAC name is (5Z)-5-[(4-hydroxy-5-methoxy-2-methylphenyl)methylidene]-3-methyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(4-hydroxy-5-methoxy-2-methylphenyl)methylidene]-3-methyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 140897181 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | (5Z)-5-[(4-hydroxy-5-methoxy-2-methylphenyl)methylidene]-3-methyl-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2\SC(=O)N(C)C2=O)c(C)cc1O |
| InChI | InChI=1S/C13H13NO4S/c1-7-4-9(15)10(18-3)5-8(7)6-11-12(16)14(2)13(17)19-11/h4-6,15H,1-3H3/b11-6- |
| InChIKey | YPWUQIBRKZODEX-WDZFZDKYSA-N |
| XLogP | 2.38 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|