About azanide;tert-butylazanide;dichloroplatinum(2+)
azanide;tert-butylazanide;dichloroplatinum(2+) (PubChem CID 140897483) has the molecular formula C4H12Cl2N2Pt
and a molecular weight of 354.14 g/mol. Its IUPAC name is azanide;tert-butylazanide;dichloroplatinum(2+).
Molecular Properties
| Compound Name | azanide;tert-butylazanide;dichloroplatinum(2+) |
| PubChem CID | 140897483 |
| Molecular Formula | C4H12Cl2N2Pt |
| Molecular Weight | 354.14 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | azanide;tert-butylazanide;dichloroplatinum(2+) |
| SMILES | CC(C)(C)[NH-].Cl[Pt+2]Cl.[NH2-] |
| InChI | InChI=1S/C4H10N.2ClH.H2N.Pt/c1-4(2,3)5;;;;/h5H,1-3H3;2*1H;1H2;/q-1;;;-1;+4/p-2 |
| InChIKey | ZKSFHKLYYIADPH-UHFFFAOYSA-L |
| XLogP | 3.93 |
| TPSA | 57.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.14 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze azanide;tert-butylazanide;dichloroplatinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanide;tert-butylazanide;dichloroplatinum(2+)?
The IUPAC name of azanide;tert-butylazanide;dichloroplatinum(2+) (CID 140897483) is azanide;tert-butylazanide;dichloroplatinum(2+).
What is the SMILES notation for azanide;tert-butylazanide;dichloroplatinum(2+)?
The canonical SMILES for azanide;tert-butylazanide;dichloroplatinum(2+) is CC(C)(C)[NH-].Cl[Pt+2]Cl.[NH2-].
What is the InChIKey of azanide;tert-butylazanide;dichloroplatinum(2+)?
The InChIKey is ZKSFHKLYYIADPH-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H10N.2ClH.H2N.Pt/c1-4(2,3)5;;;;/h5H,1-3H3;2*1H;1H2;/q-1;;;-1;+4/p-2.
What are the key properties of azanide;tert-butylazanide;dichloroplatinum(2+)?
azanide;tert-butylazanide;dichloroplatinum(2+) has a molecular weight of 354.14 g/mol, XLogP of 3.93, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for azanide;tert-butylazanide;dichloroplatinum(2+) is sourced from PubChem (CID 140897483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).