About tert-butylazanide;silane;titanium
tert-butylazanide;silane;titanium (PubChem CID 173258856) has the molecular formula C4H14NSiTi-
and a molecular weight of 152.12 g/mol. Its IUPAC name is tert-butylazanide;silane;titanium.
Molecular Properties
| Compound Name | tert-butylazanide;silane;titanium |
| PubChem CID | 173258856 |
| Molecular Formula | C4H14NSiTi- |
| Molecular Weight | 152.12 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | tert-butylazanide;silane;titanium |
| SMILES | CC(C)(C)[NH-].[SiH4].[Ti] |
| InChI | InChI=1S/C4H10N.H4Si.Ti/c1-4(2,3)5;;/h5H,1-3H3;1H4;/q-1;; |
| InChIKey | IZXYSARGPKMYDX-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.12 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butylazanide;silane;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylazanide;silane;titanium?
The IUPAC name of tert-butylazanide;silane;titanium (CID 173258856) is tert-butylazanide;silane;titanium.
What is the SMILES notation for tert-butylazanide;silane;titanium?
The canonical SMILES for tert-butylazanide;silane;titanium is CC(C)(C)[NH-].[SiH4].[Ti].
What is the InChIKey of tert-butylazanide;silane;titanium?
The InChIKey is IZXYSARGPKMYDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N.H4Si.Ti/c1-4(2,3)5;;/h5H,1-3H3;1H4;/q-1;;.
What are the key properties of tert-butylazanide;silane;titanium?
tert-butylazanide;silane;titanium has a molecular weight of 152.12 g/mol, XLogP of 0.38, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylazanide;silane;titanium is sourced from PubChem (CID 173258856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).