About methyl 4-methylsulfinylbenzoate
methyl 4-methylsulfinylbenzoate (PubChem CID 14089753) has the molecular formula C9H10O3S
and a molecular weight of 198.24 g/mol. Its IUPAC name is methyl 4-methylsulfinylbenzoate.
Molecular Properties
| Compound Name | methyl 4-methylsulfinylbenzoate |
| PubChem CID | 14089753 |
| Molecular Formula | C9H10O3S |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | methyl 4-methylsulfinylbenzoate |
| SMILES | COC(=O)c1ccc(S(C)=O)cc1 |
| InChI | InChI=1S/C9H10O3S/c1-12-9(10)7-3-5-8(6-4-7)13(2)11/h3-6H,1-2H3 |
| InChIKey | DZWCSSHXJQPVSW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-methylsulfinylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-methylsulfinylbenzoate?
The IUPAC name of methyl 4-methylsulfinylbenzoate (CID 14089753) is methyl 4-methylsulfinylbenzoate.
What is the SMILES notation for methyl 4-methylsulfinylbenzoate?
The canonical SMILES for methyl 4-methylsulfinylbenzoate is COC(=O)c1ccc(S(C)=O)cc1.
What is the InChIKey of methyl 4-methylsulfinylbenzoate?
The InChIKey is DZWCSSHXJQPVSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3S/c1-12-9(10)7-3-5-8(6-4-7)13(2)11/h3-6H,1-2H3.
What are the key properties of methyl 4-methylsulfinylbenzoate?
methyl 4-methylsulfinylbenzoate has a molecular weight of 198.24 g/mol, XLogP of 1.21, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methylsulfinylbenzoate is sourced from PubChem (CID 14089753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).