C53H36N4 — CID 140898214
N-(3-isocyano-5-pyridin-2-ylphenyl)-3-phenyl-N-(2-phenylphenyl)-5-[4-(4-phenylphenyl)-2-pyridinyl]aniline (PubChem CID 140898214) has the molecular formula C53H36N4 and a molecular weight of 728.90 g/mol. Its IUPAC name is N-(3-isocyano-5-pyridin-2-ylphenyl)-3-phenyl-N-(2-phenylphenyl)-5-[4-(4-phenylphenyl)-2-pyridinyl]aniline.
| Compound Name | N-(3-isocyano-5-pyridin-2-ylphenyl)-3-phenyl-N-(2-phenylphenyl)-5-[4-(4-phenylphenyl)-2-pyridinyl]aniline |
|---|---|
| PubChem CID | 140898214 |
| Molecular Formula | C53H36N4 |
| Molecular Weight | 728.90 g/mol |
| Exact Mass | 728.29 |
| IUPAC Name | N-(3-isocyano-5-pyridin-2-ylphenyl)-3-phenyl-N-(2-phenylphenyl)-5-[4-(4-phenylphenyl)-2-pyridinyl]aniline |
| SMILES | [C-]#[N+]c1cc(-c2ccccn2)cc(N(c2cc(-c3ccccc3)cc(-c3cc(-c4ccc(-c5ccccc5)cc4)ccn3)c2)c2ccccc2-c2ccccc2)c1 |
| InChI | InChI=1S/C53H36N4/c1-54-47-32-46(51-22-13-14-29-55-51)35-49(37-47)57(53-23-12-11-21-50(53)42-19-9-4-10-20-42)48-33-44(39-17-7-3-8-18-39)31-45(34-48)52-36-43(28-30-56-52)41-26-24-40(25-27-41)38-15-5-2-6-16-38/h2-37H |
| InChIKey | TZRKXUKKXACLQF-UHFFFAOYSA-N |
| XLogP | 14.50 |
| TPSA | 33.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.90 |
| LogP ≤ 5 | 14.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|