C51H37N5 — CID 140933319
N-[3-isocyano-5-(4-phenyl-2-pyridinyl)phenyl]-2,3-dimethyl-N-(2-phenylphenyl)-1-(4-phenyl-2-pyridinyl)indol-6-amine (PubChem CID 140933319) has the molecular formula C51H37N5 and a molecular weight of 719.89 g/mol. Its IUPAC name is N-[3-isocyano-5-(4-phenyl-2-pyridinyl)phenyl]-2,3-dimethyl-N-(2-phenylphenyl)-1-(4-phenyl-2-pyridinyl)indol-6-amine.
| Compound Name | N-[3-isocyano-5-(4-phenyl-2-pyridinyl)phenyl]-2,3-dimethyl-N-(2-phenylphenyl)-1-(4-phenyl-2-pyridinyl)indol-6-amine |
|---|---|
| PubChem CID | 140933319 |
| Molecular Formula | C51H37N5 |
| Molecular Weight | 719.89 g/mol |
| Exact Mass | 719.30 |
| IUPAC Name | N-[3-isocyano-5-(4-phenyl-2-pyridinyl)phenyl]-2,3-dimethyl-N-(2-phenylphenyl)-1-(4-phenyl-2-pyridinyl)indol-6-amine |
| SMILES | [C-]#[N+]c1cc(-c2cc(-c3ccccc3)ccn2)cc(N(c2ccc3c(C)c(C)n(-c4cc(-c5ccccc5)ccn4)c3c2)c2ccccc2-c2ccccc2)c1 |
| InChI | InChI=1S/C51H37N5/c1-35-36(2)55(51-32-41(26-28-54-51)38-17-9-5-10-18-38)50-34-44(23-24-46(35)50)56(49-22-14-13-21-47(49)39-19-11-6-12-20-39)45-30-42(29-43(33-45)52-3)48-31-40(25-27-53-48)37-15-7-4-8-16-37/h4-34H,1-2H3 |
| InChIKey | IPQHNEKLWHVIAX-UHFFFAOYSA-N |
| XLogP | 13.73 |
| TPSA | 38.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.89 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|