C39H31N5 — CID 155636182
9-(4-tert-butyl-2-pyridinyl)-N-(3-isocyano-5-pyridin-2-ylphenyl)-N-phenylcarbazol-2-amine (PubChem CID 155636182) has the molecular formula C39H31N5 and a molecular weight of 569.71 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-N-(3-isocyano-5-pyridin-2-ylphenyl)-N-phenylcarbazol-2-amine.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-N-(3-isocyano-5-pyridin-2-ylphenyl)-N-phenylcarbazol-2-amine |
|---|---|
| PubChem CID | 155636182 |
| Molecular Formula | C39H31N5 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-N-(3-isocyano-5-pyridin-2-ylphenyl)-N-phenylcarbazol-2-amine |
| SMILES | [C-]#[N+]c1cc(-c2ccccn2)cc(N(c2ccccc2)c2ccc3c4ccccc4n(-c4cc(C(C)(C)C)ccn4)c3c2)c1 |
| InChI | InChI=1S/C39H31N5/c1-39(2,3)28-19-21-42-38(24-28)44-36-16-9-8-14-33(36)34-18-17-31(26-37(34)44)43(30-12-6-5-7-13-30)32-23-27(22-29(25-32)40-4)35-15-10-11-20-41-35/h5-26H,1-3H3 |
| InChIKey | ADRGUHOCYZLLCY-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 38.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|