C52H43N5 — CID 170513447
9-(4-tert-butyl-2-pyridinyl)-2-[[3-[1-(2,6-dimethylphenyl)imidazol-4-yl]-5-isocyanophenyl]-diphenylmethyl]carbazole (PubChem CID 170513447) has the molecular formula C52H43N5 and a molecular weight of 737.95 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[[3-[1-(2,6-dimethylphenyl)imidazol-4-yl]-5-isocyanophenyl]-diphenylmethyl]carbazole.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[[3-[1-(2,6-dimethylphenyl)imidazol-4-yl]-5-isocyanophenyl]-diphenylmethyl]carbazole |
|---|---|
| PubChem CID | 170513447 |
| Molecular Formula | C52H43N5 |
| Molecular Weight | 737.95 g/mol |
| Exact Mass | 737.35 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[[3-[1-(2,6-dimethylphenyl)imidazol-4-yl]-5-isocyanophenyl]-diphenylmethyl]carbazole |
| SMILES | [C-]#[N+]c1cc(-c2cn(-c3c(C)cccc3C)cn2)cc(C(c2ccccc2)(c2ccccc2)c2ccc3c4ccccc4n(-c4cc(C(C)(C)C)ccn4)c3c2)c1 |
| InChI | InChI=1S/C52H43N5/c1-35-16-15-17-36(2)50(35)56-33-46(55-34-56)37-28-42(30-43(29-37)53-6)52(38-18-9-7-10-19-38,39-20-11-8-12-21-39)41-24-25-45-44-22-13-14-23-47(44)57(48(45)31-41)49-32-40(26-27-54-49)51(3,4)5/h7-34H,1-5H3 |
| InChIKey | KZSYEWGVTQFWAB-UHFFFAOYSA-N |
| XLogP | 12.88 |
| TPSA | 40.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.95 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|