C43H33N5O — CID 155636022
2-(2,6-dimethylphenyl)-7-[3-[1-(2,6-dimethylphenyl)imidazol-4-yl]-5-isocyanophenoxy]-9-pyridin-2-ylcarbazole (PubChem CID 155636022) has the molecular formula C43H33N5O and a molecular weight of 635.77 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)-7-[3-[1-(2,6-dimethylphenyl)imidazol-4-yl]-5-isocyanophenoxy]-9-pyridin-2-ylcarbazole.
| Compound Name | 2-(2,6-dimethylphenyl)-7-[3-[1-(2,6-dimethylphenyl)imidazol-4-yl]-5-isocyanophenoxy]-9-pyridin-2-ylcarbazole |
|---|---|
| PubChem CID | 155636022 |
| Molecular Formula | C43H33N5O |
| Molecular Weight | 635.77 g/mol |
| Exact Mass | 635.27 |
| IUPAC Name | 2-(2,6-dimethylphenyl)-7-[3-[1-(2,6-dimethylphenyl)imidazol-4-yl]-5-isocyanophenoxy]-9-pyridin-2-ylcarbazole |
| SMILES | [C-]#[N+]c1cc(Oc2ccc3c4ccc(-c5c(C)cccc5C)cc4n(-c4ccccn4)c3c2)cc(-c2cn(-c3c(C)cccc3C)cn2)c1 |
| InChI | InChI=1S/C43H33N5O/c1-27-10-8-11-28(2)42(27)31-15-17-36-37-18-16-34(24-40(37)48(39(36)22-31)41-14-6-7-19-45-41)49-35-21-32(20-33(23-35)44-5)38-25-47(26-46-38)43-29(3)12-9-13-30(43)4/h6-26H,1-4H3 |
| InChIKey | PIXUNRPKFAUUGR-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 49.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.77 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|