C45H30N6O — CID 155635916
2-[3-[4-(2,6-diphenylphenyl)-5-methyl-1,2,4-triazol-3-yl]-5-isocyanophenoxy]-9-pyridin-2-ylcarbazole (PubChem CID 155635916) has the molecular formula C45H30N6O and a molecular weight of 670.78 g/mol. Its IUPAC name is 2-[3-[4-(2,6-diphenylphenyl)-5-methyl-1,2,4-triazol-3-yl]-5-isocyanophenoxy]-9-pyridin-2-ylcarbazole.
| Compound Name | 2-[3-[4-(2,6-diphenylphenyl)-5-methyl-1,2,4-triazol-3-yl]-5-isocyanophenoxy]-9-pyridin-2-ylcarbazole |
|---|---|
| PubChem CID | 155635916 |
| Molecular Formula | C45H30N6O |
| Molecular Weight | 670.78 g/mol |
| Exact Mass | 670.25 |
| IUPAC Name | 2-[3-[4-(2,6-diphenylphenyl)-5-methyl-1,2,4-triazol-3-yl]-5-isocyanophenoxy]-9-pyridin-2-ylcarbazole |
| SMILES | [C-]#[N+]c1cc(Oc2ccc3c4ccccc4n(-c4ccccn4)c3c2)cc(-c2nnc(C)n2-c2c(-c3ccccc3)cccc2-c2ccccc2)c1 |
| InChI | InChI=1S/C45H30N6O/c1-30-48-49-45(50(30)44-37(31-14-5-3-6-15-31)19-13-20-38(44)32-16-7-4-8-17-32)33-26-34(46-2)28-36(27-33)52-35-23-24-40-39-18-9-10-21-41(39)51(42(40)29-35)43-22-11-12-25-47-43/h3-29H,1H3 |
| InChIKey | XXNRIELWHPUPHH-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 62.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.78 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|