C35H26N5O+ — CID 167399361
2-[3-[1-(2,6-dimethylphenyl)-4H-imidazol-1-ium-4-yl]-5-isocyanophenoxy]-9-pyridin-2-ylcarbazole (PubChem CID 167399361) has the molecular formula C35H26N5O+ and a molecular weight of 532.63 g/mol. Its IUPAC name is 2-[3-[1-(2,6-dimethylphenyl)-4H-imidazol-1-ium-4-yl]-5-isocyanophenoxy]-9-pyridin-2-ylcarbazole.
| Compound Name | 2-[3-[1-(2,6-dimethylphenyl)-4H-imidazol-1-ium-4-yl]-5-isocyanophenoxy]-9-pyridin-2-ylcarbazole |
|---|---|
| PubChem CID | 167399361 |
| Molecular Formula | C35H26N5O+ |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | 2-[3-[1-(2,6-dimethylphenyl)-4H-imidazol-1-ium-4-yl]-5-isocyanophenoxy]-9-pyridin-2-ylcarbazole |
| SMILES | [C-]#[N+]c1cc(Oc2ccc3c4ccccc4n(-c4ccccn4)c3c2)cc(C2C=[N+](c3c(C)cccc3C)C=N2)c1 |
| InChI | InChI=1S/C35H26N5O/c1-23-9-8-10-24(2)35(23)39-21-31(38-22-39)25-17-26(36-3)19-28(18-25)41-27-14-15-30-29-11-4-5-12-32(29)40(33(30)20-27)34-13-6-7-16-37-34/h4-22,31H,1-2H3/q+1 |
| InChIKey | PUFSYIMIQUJNEE-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 46.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|