C45H37N5O — CID 155635930
2-[3-isocyano-5-[1-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazol-2-yl]phenoxy]-9-pyridin-2-ylcarbazole (PubChem CID 155635930) has the molecular formula C45H37N5O and a molecular weight of 663.83 g/mol. Its IUPAC name is 2-[3-isocyano-5-[1-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazol-2-yl]phenoxy]-9-pyridin-2-ylcarbazole.
| Compound Name | 2-[3-isocyano-5-[1-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazol-2-yl]phenoxy]-9-pyridin-2-ylcarbazole |
|---|---|
| PubChem CID | 155635930 |
| Molecular Formula | C45H37N5O |
| Molecular Weight | 663.83 g/mol |
| Exact Mass | 663.30 |
| IUPAC Name | 2-[3-isocyano-5-[1-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazol-2-yl]phenoxy]-9-pyridin-2-ylcarbazole |
| SMILES | [C-]#[N+]c1cc(Oc2ccc3c4ccccc4n(-c4ccccn4)c3c2)cc(-c2nccn2-c2c(C(C)C)cc(-c3ccccc3)cc2C(C)C)c1 |
| InChI | InChI=1S/C45H37N5O/c1-29(2)39-25-32(31-13-7-6-8-14-31)26-40(30(3)4)44(39)49-22-21-48-45(49)33-23-34(46-5)27-36(24-33)51-35-18-19-38-37-15-9-10-16-41(37)50(42(38)28-35)43-17-11-12-20-47-43/h6-30H,1-4H3 |
| InChIKey | HEXBYSPZPIMQFB-UHFFFAOYSA-N |
| XLogP | 12.29 |
| TPSA | 49.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.83 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|