C20H39NO2 — CID 140899125
2-(2,2-dimethylpropoxy)-7-[3-[(2-methylpropan-2-yl)oxy]propyl]-7-azaspiro[3.5]nonane (PubChem CID 140899125) has the molecular formula C20H39NO2 and a molecular weight of 325.54 g/mol. Its IUPAC name is 2-(2,2-dimethylpropoxy)-7-[3-[(2-methylpropan-2-yl)oxy]propyl]-7-azaspiro[3.5]nonane.
| Compound Name | 2-(2,2-dimethylpropoxy)-7-[3-[(2-methylpropan-2-yl)oxy]propyl]-7-azaspiro[3.5]nonane |
|---|---|
| PubChem CID | 140899125 |
| Molecular Formula | C20H39NO2 |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.30 |
| IUPAC Name | 2-(2,2-dimethylpropoxy)-7-[3-[(2-methylpropan-2-yl)oxy]propyl]-7-azaspiro[3.5]nonane |
| SMILES | CC(C)(C)COC1CC2(CCN(CCCOC(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C20H39NO2/c1-18(2,3)16-22-17-14-20(15-17)8-11-21(12-9-20)10-7-13-23-19(4,5)6/h17H,7-16H2,1-6H3 |
| InChIKey | RUNFMGZFRSJYIM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|