C17H33F3N6O — CID 140900472
1-[4-(4-aminobutylamino)-6-methyl-1,3-diazinan-2-yl]-3-[4-(trifluoromethyl)cyclohexyl]urea (PubChem CID 140900472) has the molecular formula C17H33F3N6O and a molecular weight of 394.49 g/mol. Its IUPAC name is 1-[4-(4-aminobutylamino)-6-methyl-1,3-diazinan-2-yl]-3-[4-(trifluoromethyl)cyclohexyl]urea.
| Compound Name | 1-[4-(4-aminobutylamino)-6-methyl-1,3-diazinan-2-yl]-3-[4-(trifluoromethyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 140900472 |
| Molecular Formula | C17H33F3N6O |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 1-[4-(4-aminobutylamino)-6-methyl-1,3-diazinan-2-yl]-3-[4-(trifluoromethyl)cyclohexyl]urea |
| SMILES | CC1CC(NCCCCN)NC(NC(=O)NC2CCC(C(F)(F)F)CC2)N1 |
| InChI | InChI=1S/C17H33F3N6O/c1-11-10-14(22-9-3-2-8-21)25-15(23-11)26-16(27)24-13-6-4-12(5-7-13)17(18,19)20/h11-15,22-23,25H,2-10,21H2,1H3,(H2,24,26,27) |
| InChIKey | IOPFQKKJHLMTOC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|