C17H35N5O3 — CID 140900518
1-[4-[2-(2-hydroxyethoxy)ethylamino]-6-methyl-1,3-diazinan-2-yl]-3-(3-methylcyclohexyl)urea (PubChem CID 140900518) has the molecular formula C17H35N5O3 and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-[4-[2-(2-hydroxyethoxy)ethylamino]-6-methyl-1,3-diazinan-2-yl]-3-(3-methylcyclohexyl)urea.
| Compound Name | 1-[4-[2-(2-hydroxyethoxy)ethylamino]-6-methyl-1,3-diazinan-2-yl]-3-(3-methylcyclohexyl)urea |
|---|---|
| PubChem CID | 140900518 |
| Molecular Formula | C17H35N5O3 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | 1-[4-[2-(2-hydroxyethoxy)ethylamino]-6-methyl-1,3-diazinan-2-yl]-3-(3-methylcyclohexyl)urea |
| SMILES | CC1CCCC(NC(=O)NC2NC(C)CC(NCCOCCO)N2)C1 |
| InChI | InChI=1S/C17H35N5O3/c1-12-4-3-5-14(10-12)20-17(24)22-16-19-13(2)11-15(21-16)18-6-8-25-9-7-23/h12-16,18-19,21,23H,3-11H2,1-2H3,(H2,20,22,24) |
| InChIKey | XGUHOXLSCOXMPA-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|