C17H32F3N5O3 — CID 140900537
1-[4-[2-(2-hydroxyethoxy)ethylamino]-6-methyl-1,3-diazinan-2-yl]-3-[4-(trifluoromethyl)cyclohexyl]urea (PubChem CID 140900537) has the molecular formula C17H32F3N5O3 and a molecular weight of 411.47 g/mol. Its IUPAC name is 1-[4-[2-(2-hydroxyethoxy)ethylamino]-6-methyl-1,3-diazinan-2-yl]-3-[4-(trifluoromethyl)cyclohexyl]urea.
| Compound Name | 1-[4-[2-(2-hydroxyethoxy)ethylamino]-6-methyl-1,3-diazinan-2-yl]-3-[4-(trifluoromethyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 140900537 |
| Molecular Formula | C17H32F3N5O3 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 1-[4-[2-(2-hydroxyethoxy)ethylamino]-6-methyl-1,3-diazinan-2-yl]-3-[4-(trifluoromethyl)cyclohexyl]urea |
| SMILES | CC1CC(NCCOCCO)NC(NC(=O)NC2CCC(C(F)(F)F)CC2)N1 |
| InChI | InChI=1S/C17H32F3N5O3/c1-11-10-14(21-6-8-28-9-7-26)24-15(22-11)25-16(27)23-13-4-2-12(3-5-13)17(18,19)20/h11-15,21-22,24,26H,2-10H2,1H3,(H2,23,25,27) |
| InChIKey | MYXUCZQRBPODHZ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|