C17H31ClF3N5O3 — CID 156677466
1-[4-chloro-3-(trifluoromethyl)cyclohexyl]-3-[4-[2-(2-hydroxyethoxy)ethylamino]-6-methyl-1,3-diazinan-2-yl]urea (PubChem CID 156677466) has the molecular formula C17H31ClF3N5O3 and a molecular weight of 445.91 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)cyclohexyl]-3-[4-[2-(2-hydroxyethoxy)ethylamino]-6-methyl-1,3-diazinan-2-yl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)cyclohexyl]-3-[4-[2-(2-hydroxyethoxy)ethylamino]-6-methyl-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 156677466 |
| Molecular Formula | C17H31ClF3N5O3 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)cyclohexyl]-3-[4-[2-(2-hydroxyethoxy)ethylamino]-6-methyl-1,3-diazinan-2-yl]urea |
| SMILES | CC1CC(NCCOCCO)NC(NC(=O)NC2CCC(Cl)C(C(F)(F)F)C2)N1 |
| InChI | InChI=1S/C17H31ClF3N5O3/c1-10-8-14(22-4-6-29-7-5-27)25-15(23-10)26-16(28)24-11-2-3-13(18)12(9-11)17(19,20)21/h10-15,22-23,25,27H,2-9H2,1H3,(H2,24,26,28) |
| InChIKey | FSLVWASXQUPHIS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|