C15H27ClF3N5O2 — CID 140900500
1-[4-chloro-3-(trifluoromethyl)cyclohexyl]-3-[4-(2-hydroxyethylamino)-6-methyl-1,3-diazinan-2-yl]urea (PubChem CID 140900500) has the molecular formula C15H27ClF3N5O2 and a molecular weight of 401.86 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)cyclohexyl]-3-[4-(2-hydroxyethylamino)-6-methyl-1,3-diazinan-2-yl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)cyclohexyl]-3-[4-(2-hydroxyethylamino)-6-methyl-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 140900500 |
| Molecular Formula | C15H27ClF3N5O2 |
| Molecular Weight | 401.86 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)cyclohexyl]-3-[4-(2-hydroxyethylamino)-6-methyl-1,3-diazinan-2-yl]urea |
| SMILES | CC1CC(NCCO)NC(NC(=O)NC2CCC(Cl)C(C(F)(F)F)C2)N1 |
| InChI | InChI=1S/C15H27ClF3N5O2/c1-8-6-12(20-4-5-25)23-13(21-8)24-14(26)22-9-2-3-11(16)10(7-9)15(17,18)19/h8-13,20-21,23,25H,2-7H2,1H3,(H2,22,24,26) |
| InChIKey | REIJBBFQFOXVAS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.86 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|