C16H28ClF3N6O2 — CID 140900569
3-[[2-[[4-chloro-3-(trifluoromethyl)cyclohexyl]carbamoylamino]-6-methyl-1,3-diazinan-4-yl]amino]propanamide (PubChem CID 140900569) has the molecular formula C16H28ClF3N6O2 and a molecular weight of 428.89 g/mol. Its IUPAC name is 3-[[2-[[4-chloro-3-(trifluoromethyl)cyclohexyl]carbamoylamino]-6-methyl-1,3-diazinan-4-yl]amino]propanamide.
| Compound Name | 3-[[2-[[4-chloro-3-(trifluoromethyl)cyclohexyl]carbamoylamino]-6-methyl-1,3-diazinan-4-yl]amino]propanamide |
|---|---|
| PubChem CID | 140900569 |
| Molecular Formula | C16H28ClF3N6O2 |
| Molecular Weight | 428.89 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 3-[[2-[[4-chloro-3-(trifluoromethyl)cyclohexyl]carbamoylamino]-6-methyl-1,3-diazinan-4-yl]amino]propanamide |
| SMILES | CC1CC(NCCC(N)=O)NC(NC(=O)NC2CCC(Cl)C(C(F)(F)F)C2)N1 |
| InChI | InChI=1S/C16H28ClF3N6O2/c1-8-6-13(22-5-4-12(21)27)25-14(23-8)26-15(28)24-9-2-3-11(17)10(7-9)16(18,19)20/h8-11,13-14,22-23,25H,2-7H2,1H3,(H2,21,27)(H2,24,26,28) |
| InChIKey | JGYXDOGMVZWLSV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 120.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.89 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|