C17H30ClF3N6O — CID 140900501
1-[4-chloro-3-(trifluoromethyl)cyclohexyl]-3-[4-methyl-6-(pyrrolidin-3-ylamino)-1,3-diazinan-2-yl]urea (PubChem CID 140900501) has the molecular formula C17H30ClF3N6O and a molecular weight of 426.92 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)cyclohexyl]-3-[4-methyl-6-(pyrrolidin-3-ylamino)-1,3-diazinan-2-yl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)cyclohexyl]-3-[4-methyl-6-(pyrrolidin-3-ylamino)-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 140900501 |
| Molecular Formula | C17H30ClF3N6O |
| Molecular Weight | 426.92 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)cyclohexyl]-3-[4-methyl-6-(pyrrolidin-3-ylamino)-1,3-diazinan-2-yl]urea |
| SMILES | CC1CC(NC2CCNC2)NC(NC(=O)NC2CCC(Cl)C(C(F)(F)F)C2)N1 |
| InChI | InChI=1S/C17H30ClF3N6O/c1-9-6-14(24-11-4-5-22-8-11)26-15(23-9)27-16(28)25-10-2-3-13(18)12(7-10)17(19,20)21/h9-15,22-24,26H,2-8H2,1H3,(H2,25,27,28) |
| InChIKey | CAZASXIQXMXFKC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.92 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|