C13H22ClF3N4O — CID 140900542
1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-[4-(trifluoromethyl)cyclohexyl]urea (PubChem CID 140900542) has the molecular formula C13H22ClF3N4O and a molecular weight of 342.79 g/mol. Its IUPAC name is 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-[4-(trifluoromethyl)cyclohexyl]urea.
| Compound Name | 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-[4-(trifluoromethyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 140900542 |
| Molecular Formula | C13H22ClF3N4O |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-[4-(trifluoromethyl)cyclohexyl]urea |
| SMILES | CC1CC(Cl)NC(NC(=O)NC2CCC(C(F)(F)F)CC2)N1 |
| InChI | InChI=1S/C13H22ClF3N4O/c1-7-6-10(14)20-11(18-7)21-12(22)19-9-4-2-8(3-5-9)13(15,16)17/h7-11,18,20H,2-6H2,1H3,(H2,19,21,22) |
| InChIKey | RRNSGFREKKYRCE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|