C16H29ClF3N5O2 — CID 140900637
1-[4-chloro-3-(trifluoromethyl)cyclohexyl]-3-[4-(2-hydroxypropylamino)-6-methyl-1,3-diazinan-2-yl]urea (PubChem CID 140900637) has the molecular formula C16H29ClF3N5O2 and a molecular weight of 415.89 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)cyclohexyl]-3-[4-(2-hydroxypropylamino)-6-methyl-1,3-diazinan-2-yl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)cyclohexyl]-3-[4-(2-hydroxypropylamino)-6-methyl-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 140900637 |
| Molecular Formula | C16H29ClF3N5O2 |
| Molecular Weight | 415.89 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)cyclohexyl]-3-[4-(2-hydroxypropylamino)-6-methyl-1,3-diazinan-2-yl]urea |
| SMILES | CC(O)CNC1CC(C)NC(NC(=O)NC2CCC(Cl)C(C(F)(F)F)C2)N1 |
| InChI | InChI=1S/C16H29ClF3N5O2/c1-8-5-13(21-7-9(2)26)24-14(22-8)25-15(27)23-10-3-4-12(17)11(6-10)16(18,19)20/h8-14,21-22,24,26H,3-7H2,1-2H3,(H2,23,25,27) |
| InChIKey | FKXHJSJQNYTQPB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.89 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|