C14H27ClFN5O2 — CID 140900571
1-(3-chloro-4-fluorocyclohexyl)-3-[4-(2-hydroxyethylamino)-6-methyl-1,3-diazinan-2-yl]urea (PubChem CID 140900571) has the molecular formula C14H27ClFN5O2 and a molecular weight of 351.85 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorocyclohexyl)-3-[4-(2-hydroxyethylamino)-6-methyl-1,3-diazinan-2-yl]urea.
| Compound Name | 1-(3-chloro-4-fluorocyclohexyl)-3-[4-(2-hydroxyethylamino)-6-methyl-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 140900571 |
| Molecular Formula | C14H27ClFN5O2 |
| Molecular Weight | 351.85 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-(3-chloro-4-fluorocyclohexyl)-3-[4-(2-hydroxyethylamino)-6-methyl-1,3-diazinan-2-yl]urea |
| SMILES | CC1CC(NCCO)NC(NC(=O)NC2CCC(F)C(Cl)C2)N1 |
| InChI | InChI=1S/C14H27ClFN5O2/c1-8-6-12(17-4-5-22)20-13(18-8)21-14(23)19-9-2-3-11(16)10(15)7-9/h8-13,17-18,20,22H,2-7H2,1H3,(H2,19,21,23) |
| InChIKey | YAMVBAWPJAZNMJ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.85 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|