C15H29ClFN5O2 — CID 140900556
1-(3-chloro-4-fluorocyclohexyl)-3-[4-(2-hydroxypropylamino)-6-methyl-1,3-diazinan-2-yl]urea (PubChem CID 140900556) has the molecular formula C15H29ClFN5O2 and a molecular weight of 365.88 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorocyclohexyl)-3-[4-(2-hydroxypropylamino)-6-methyl-1,3-diazinan-2-yl]urea.
| Compound Name | 1-(3-chloro-4-fluorocyclohexyl)-3-[4-(2-hydroxypropylamino)-6-methyl-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 140900556 |
| Molecular Formula | C15H29ClFN5O2 |
| Molecular Weight | 365.88 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 1-(3-chloro-4-fluorocyclohexyl)-3-[4-(2-hydroxypropylamino)-6-methyl-1,3-diazinan-2-yl]urea |
| SMILES | CC(O)CNC1CC(C)NC(NC(=O)NC2CCC(F)C(Cl)C2)N1 |
| InChI | InChI=1S/C15H29ClFN5O2/c1-8-5-13(18-7-9(2)23)21-14(19-8)22-15(24)20-10-3-4-12(17)11(16)6-10/h8-14,18-19,21,23H,3-7H2,1-2H3,(H2,20,22,24) |
| InChIKey | LIQIMEPOVYTGSU-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.88 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|