C15H29ClFN5O — CID 140900553
1-(3-chloro-4-fluorocyclohexyl)-3-[4-methyl-6-(propylamino)-1,3-diazinan-2-yl]urea (PubChem CID 140900553) has the molecular formula C15H29ClFN5O and a molecular weight of 349.88 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorocyclohexyl)-3-[4-methyl-6-(propylamino)-1,3-diazinan-2-yl]urea.
| Compound Name | 1-(3-chloro-4-fluorocyclohexyl)-3-[4-methyl-6-(propylamino)-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 140900553 |
| Molecular Formula | C15H29ClFN5O |
| Molecular Weight | 349.88 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 1-(3-chloro-4-fluorocyclohexyl)-3-[4-methyl-6-(propylamino)-1,3-diazinan-2-yl]urea |
| SMILES | CCCNC1CC(C)NC(NC(=O)NC2CCC(F)C(Cl)C2)N1 |
| InChI | InChI=1S/C15H29ClFN5O/c1-3-6-18-13-7-9(2)19-14(21-13)22-15(23)20-10-4-5-12(17)11(16)8-10/h9-14,18-19,21H,3-8H2,1-2H3,(H2,20,22,23) |
| InChIKey | PFZWUKQRBSPQDH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.88 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|