C16H32Cl2N6O — CID 140900527
1-[4-(4-aminobutylamino)-6-methyl-1,3-diazinan-2-yl]-3-(3,4-dichlorocyclohexyl)urea (PubChem CID 140900527) has the molecular formula C16H32Cl2N6O and a molecular weight of 395.38 g/mol. Its IUPAC name is 1-[4-(4-aminobutylamino)-6-methyl-1,3-diazinan-2-yl]-3-(3,4-dichlorocyclohexyl)urea.
| Compound Name | 1-[4-(4-aminobutylamino)-6-methyl-1,3-diazinan-2-yl]-3-(3,4-dichlorocyclohexyl)urea |
|---|---|
| PubChem CID | 140900527 |
| Molecular Formula | C16H32Cl2N6O |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 1-[4-(4-aminobutylamino)-6-methyl-1,3-diazinan-2-yl]-3-(3,4-dichlorocyclohexyl)urea |
| SMILES | CC1CC(NCCCCN)NC(NC(=O)NC2CCC(Cl)C(Cl)C2)N1 |
| InChI | InChI=1S/C16H32Cl2N6O/c1-10-8-14(20-7-3-2-6-19)23-15(21-10)24-16(25)22-11-4-5-12(17)13(18)9-11/h10-15,20-21,23H,2-9,19H2,1H3,(H2,22,24,25) |
| InChIKey | QMVLBDLYGYKGAX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|