C12H21Cl2FN4O — CID 140900545
1-(3-chloro-4-fluorocyclohexyl)-3-(4-chloro-6-methyl-1,3-diazinan-2-yl)urea (PubChem CID 140900545) has the molecular formula C12H21Cl2FN4O and a molecular weight of 327.23 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorocyclohexyl)-3-(4-chloro-6-methyl-1,3-diazinan-2-yl)urea.
| Compound Name | 1-(3-chloro-4-fluorocyclohexyl)-3-(4-chloro-6-methyl-1,3-diazinan-2-yl)urea |
|---|---|
| PubChem CID | 140900545 |
| Molecular Formula | C12H21Cl2FN4O |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 1-(3-chloro-4-fluorocyclohexyl)-3-(4-chloro-6-methyl-1,3-diazinan-2-yl)urea |
| SMILES | CC1CC(Cl)NC(NC(=O)NC2CCC(F)C(Cl)C2)N1 |
| InChI | InChI=1S/C12H21Cl2FN4O/c1-6-4-10(14)18-11(16-6)19-12(20)17-7-2-3-9(15)8(13)5-7/h6-11,16,18H,2-5H2,1H3,(H2,17,19,20) |
| InChIKey | JMGXTBMJIMZKEM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|