C11H18Cl3FN4O — CID 153299904
1-(4-chloro-5-fluoro-1,3-diazinan-2-yl)-3-(3,4-dichlorocyclohexyl)urea (PubChem CID 153299904) has the molecular formula C11H18Cl3FN4O and a molecular weight of 347.65 g/mol. Its IUPAC name is 1-(4-chloro-5-fluoro-1,3-diazinan-2-yl)-3-(3,4-dichlorocyclohexyl)urea.
| Compound Name | 1-(4-chloro-5-fluoro-1,3-diazinan-2-yl)-3-(3,4-dichlorocyclohexyl)urea |
|---|---|
| PubChem CID | 153299904 |
| Molecular Formula | C11H18Cl3FN4O |
| Molecular Weight | 347.65 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 1-(4-chloro-5-fluoro-1,3-diazinan-2-yl)-3-(3,4-dichlorocyclohexyl)urea |
| SMILES | O=C(NC1CCC(Cl)C(Cl)C1)NC1NCC(F)C(Cl)N1 |
| InChI | InChI=1S/C11H18Cl3FN4O/c12-6-2-1-5(3-7(6)13)17-11(20)19-10-16-4-8(15)9(14)18-10/h5-10,16,18H,1-4H2,(H2,17,19,20) |
| InChIKey | AVNKAGFZLHHNER-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.65 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|