C16H31Cl2FN6O — CID 153299867
1-(3,4-dichlorocyclohexyl)-3-[4-[3-(dimethylamino)propylamino]-5-fluoro-1,3-diazinan-2-yl]urea (PubChem CID 153299867) has the molecular formula C16H31Cl2FN6O and a molecular weight of 413.37 g/mol. Its IUPAC name is 1-(3,4-dichlorocyclohexyl)-3-[4-[3-(dimethylamino)propylamino]-5-fluoro-1,3-diazinan-2-yl]urea.
| Compound Name | 1-(3,4-dichlorocyclohexyl)-3-[4-[3-(dimethylamino)propylamino]-5-fluoro-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 153299867 |
| Molecular Formula | C16H31Cl2FN6O |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 1-(3,4-dichlorocyclohexyl)-3-[4-[3-(dimethylamino)propylamino]-5-fluoro-1,3-diazinan-2-yl]urea |
| SMILES | CN(C)CCCNC1NC(NC(=O)NC2CCC(Cl)C(Cl)C2)NCC1F |
| InChI | InChI=1S/C16H31Cl2FN6O/c1-25(2)7-3-6-20-14-13(19)9-21-15(23-14)24-16(26)22-10-4-5-11(17)12(18)8-10/h10-15,20-21,23H,3-9H2,1-2H3,(H2,22,24,26) |
| InChIKey | CXGJWDZWLGKIOR-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|