C17H32ClFN6O2 — CID 140900584
N-[3-[[2-[(3-chloro-4-fluorocyclohexyl)carbamoylamino]-6-methyl-1,3-diazinan-4-yl]amino]propyl]acetamide (PubChem CID 140900584) has the molecular formula C17H32ClFN6O2 and a molecular weight of 406.93 g/mol. Its IUPAC name is N-[3-[[2-[(3-chloro-4-fluorocyclohexyl)carbamoylamino]-6-methyl-1,3-diazinan-4-yl]amino]propyl]acetamide.
| Compound Name | N-[3-[[2-[(3-chloro-4-fluorocyclohexyl)carbamoylamino]-6-methyl-1,3-diazinan-4-yl]amino]propyl]acetamide |
|---|---|
| PubChem CID | 140900584 |
| Molecular Formula | C17H32ClFN6O2 |
| Molecular Weight | 406.93 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | N-[3-[[2-[(3-chloro-4-fluorocyclohexyl)carbamoylamino]-6-methyl-1,3-diazinan-4-yl]amino]propyl]acetamide |
| SMILES | CC(=O)NCCCNC1CC(C)NC(NC(=O)NC2CCC(F)C(Cl)C2)N1 |
| InChI | InChI=1S/C17H32ClFN6O2/c1-10-8-15(21-7-3-6-20-11(2)26)24-16(22-10)25-17(27)23-12-4-5-14(19)13(18)9-12/h10,12-16,21-22,24H,3-9H2,1-2H3,(H,20,26)(H2,23,25,27) |
| InChIKey | PJILAVMZEFYPKV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 106.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.93 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|