C16H33BClFN6O2 — CID 140900521
N-[2-[[2-[(3-chloro-4-fluorocyclohexyl)carbamoylamino]-6-methyl-1,3-diazinan-4-yl]amino]ethyl]-N-dimethylboronamidic acid (PubChem CID 140900521) has the molecular formula C16H33BClFN6O2 and a molecular weight of 406.74 g/mol. Its IUPAC name is N-[2-[[2-[(3-chloro-4-fluorocyclohexyl)carbamoylamino]-6-methyl-1,3-diazinan-4-yl]amino]ethyl]-N-dimethylboronamidic acid.
| Compound Name | N-[2-[[2-[(3-chloro-4-fluorocyclohexyl)carbamoylamino]-6-methyl-1,3-diazinan-4-yl]amino]ethyl]-N-dimethylboronamidic acid |
|---|---|
| PubChem CID | 140900521 |
| Molecular Formula | C16H33BClFN6O2 |
| Molecular Weight | 406.74 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | N-[2-[[2-[(3-chloro-4-fluorocyclohexyl)carbamoylamino]-6-methyl-1,3-diazinan-4-yl]amino]ethyl]-N-dimethylboronamidic acid |
| SMILES | CB(O)N(C)CCNC1CC(C)NC(NC(=O)NC2CCC(F)C(Cl)C2)N1 |
| InChI | InChI=1S/C16H33BClFN6O2/c1-10-8-14(20-6-7-25(3)17(2)27)23-15(21-10)24-16(26)22-11-4-5-13(19)12(18)9-11/h10-15,20-21,23,27H,4-9H2,1-3H3,(H2,22,24,26) |
| InChIKey | NBTPUYFUTIVMIC-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 100.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.74 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|