C15H28Cl2N6O2 — CID 140900487
3-[[2-[(3,4-dichlorocyclohexyl)carbamoylamino]-6-methyl-1,3-diazinan-4-yl]amino]propanamide (PubChem CID 140900487) has the molecular formula C15H28Cl2N6O2 and a molecular weight of 395.34 g/mol. Its IUPAC name is 3-[[2-[(3,4-dichlorocyclohexyl)carbamoylamino]-6-methyl-1,3-diazinan-4-yl]amino]propanamide.
| Compound Name | 3-[[2-[(3,4-dichlorocyclohexyl)carbamoylamino]-6-methyl-1,3-diazinan-4-yl]amino]propanamide |
|---|---|
| PubChem CID | 140900487 |
| Molecular Formula | C15H28Cl2N6O2 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 3-[[2-[(3,4-dichlorocyclohexyl)carbamoylamino]-6-methyl-1,3-diazinan-4-yl]amino]propanamide |
| SMILES | CC1CC(NCCC(N)=O)NC(NC(=O)NC2CCC(Cl)C(Cl)C2)N1 |
| InChI | InChI=1S/C15H28Cl2N6O2/c1-8-6-13(19-5-4-12(18)24)22-14(20-8)23-15(25)21-9-2-3-10(16)11(17)7-9/h8-11,13-14,19-20,22H,2-7H2,1H3,(H2,18,24)(H2,21,23,25) |
| InChIKey | FTNQKCCNXGOZLR-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 120.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|