C18H33F3N6O3 — CID 140900641
N-[3-[[6-methyl-2-[[4-(trifluoromethoxy)cyclohexyl]carbamoylamino]-1,3-diazinan-4-yl]amino]propyl]acetamide (PubChem CID 140900641) has the molecular formula C18H33F3N6O3 and a molecular weight of 438.50 g/mol. Its IUPAC name is N-[3-[[6-methyl-2-[[4-(trifluoromethoxy)cyclohexyl]carbamoylamino]-1,3-diazinan-4-yl]amino]propyl]acetamide.
| Compound Name | N-[3-[[6-methyl-2-[[4-(trifluoromethoxy)cyclohexyl]carbamoylamino]-1,3-diazinan-4-yl]amino]propyl]acetamide |
|---|---|
| PubChem CID | 140900641 |
| Molecular Formula | C18H33F3N6O3 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | N-[3-[[6-methyl-2-[[4-(trifluoromethoxy)cyclohexyl]carbamoylamino]-1,3-diazinan-4-yl]amino]propyl]acetamide |
| SMILES | CC(=O)NCCCNC1CC(C)NC(NC(=O)NC2CCC(OC(F)(F)F)CC2)N1 |
| InChI | InChI=1S/C18H33F3N6O3/c1-11-10-15(23-9-3-8-22-12(2)28)26-16(24-11)27-17(29)25-13-4-6-14(7-5-13)30-18(19,20)21/h11,13-16,23-24,26H,3-10H2,1-2H3,(H,22,28)(H2,25,27,29) |
| InChIKey | UAPNPBQSJFKICH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 115.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|