C18H16FN3O3 — CID 140901323
(4R,7S)-7-fluoro-4-[(6-isocyano-7-methoxyisoquinolin-1-yl)oxymethyl]-5-azaspiro[2.4]heptan-6-one (PubChem CID 140901323) has the molecular formula C18H16FN3O3 and a molecular weight of 341.34 g/mol. Its IUPAC name is (4R,7S)-7-fluoro-4-[(6-isocyano-7-methoxyisoquinolin-1-yl)oxymethyl]-5-azaspiro[2.4]heptan-6-one.
| Compound Name | (4R,7S)-7-fluoro-4-[(6-isocyano-7-methoxyisoquinolin-1-yl)oxymethyl]-5-azaspiro[2.4]heptan-6-one |
|---|---|
| PubChem CID | 140901323 |
| Molecular Formula | C18H16FN3O3 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (4R,7S)-7-fluoro-4-[(6-isocyano-7-methoxyisoquinolin-1-yl)oxymethyl]-5-azaspiro[2.4]heptan-6-one |
| SMILES | [C-]#[N+]c1cc2ccnc(OC[C@@H]3NC(=O)[C@@H](F)C34CC4)c2cc1OC |
| InChI | InChI=1S/C18H16FN3O3/c1-20-12-7-10-3-6-21-17(11(10)8-13(12)24-2)25-9-14-18(4-5-18)15(19)16(23)22-14/h3,6-8,14-15H,4-5,9H2,2H3,(H,22,23)/t14-,15+/m0/s1 |
| InChIKey | QPWGEQFZPNYXCJ-LSDHHAIUSA-N |
| XLogP | 2.79 |
| TPSA | 64.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|