C16H16N2O4S — CID 142580683
7-methoxy-1-[[(2S)-5-oxopyrrolidin-2-yl]methoxy]isoquinoline-6-carbothioic S-acid (PubChem CID 142580683) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is 7-methoxy-1-[[(2S)-5-oxopyrrolidin-2-yl]methoxy]isoquinoline-6-carbothioic S-acid.
| Compound Name | 7-methoxy-1-[[(2S)-5-oxopyrrolidin-2-yl]methoxy]isoquinoline-6-carbothioic S-acid |
|---|---|
| PubChem CID | 142580683 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 7-methoxy-1-[[(2S)-5-oxopyrrolidin-2-yl]methoxy]isoquinoline-6-carbothioic S-acid |
| SMILES | COc1cc2c(OC[C@@H]3CCC(=O)N3)nccc2cc1C(=O)S |
| InChI | InChI=1S/C16H16N2O4S/c1-21-13-7-11-9(6-12(13)16(20)23)4-5-17-15(11)22-8-10-2-3-14(19)18-10/h4-7,10H,2-3,8H2,1H3,(H,18,19)(H,20,23)/t10-/m0/s1 |
| InChIKey | MEYOWFLNAKYQJK-JTQLQIEISA-N |
| XLogP | 1.97 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|