C19H19N3O3 — CID 169212825
4-ethyl-6-[[(2S)-5-oxopyrrolidin-2-yl]methoxy]-2H-pyrido[3,4-g]isoquinolin-1-one (PubChem CID 169212825) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 4-ethyl-6-[[(2S)-5-oxopyrrolidin-2-yl]methoxy]-2H-pyrido[3,4-g]isoquinolin-1-one.
| Compound Name | 4-ethyl-6-[[(2S)-5-oxopyrrolidin-2-yl]methoxy]-2H-pyrido[3,4-g]isoquinolin-1-one |
|---|---|
| PubChem CID | 169212825 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 4-ethyl-6-[[(2S)-5-oxopyrrolidin-2-yl]methoxy]-2H-pyrido[3,4-g]isoquinolin-1-one |
| SMILES | CCc1c[nH]c(=O)c2cc3ccnc(OC[C@@H]4CCC(=O)N4)c3cc12 |
| InChI | InChI=1S/C19H19N3O3/c1-2-11-9-21-18(24)16-7-12-5-6-20-19(15(12)8-14(11)16)25-10-13-3-4-17(23)22-13/h5-9,13H,2-4,10H2,1H3,(H,21,24)(H,22,23)/t13-/m0/s1 |
| InChIKey | APQZSUPHKOZKBY-ZDUSSCGKSA-N |
| XLogP | 2.30 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|