C20H19N3O3 — CID 169212887
6-[[(2S)-5-oxopyrrolidin-2-yl]methoxy]-4-prop-2-enyl-2H-pyrido[3,4-g]isoquinolin-1-one (PubChem CID 169212887) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 6-[[(2S)-5-oxopyrrolidin-2-yl]methoxy]-4-prop-2-enyl-2H-pyrido[3,4-g]isoquinolin-1-one.
| Compound Name | 6-[[(2S)-5-oxopyrrolidin-2-yl]methoxy]-4-prop-2-enyl-2H-pyrido[3,4-g]isoquinolin-1-one |
|---|---|
| PubChem CID | 169212887 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 6-[[(2S)-5-oxopyrrolidin-2-yl]methoxy]-4-prop-2-enyl-2H-pyrido[3,4-g]isoquinolin-1-one |
| SMILES | C=CCc1c[nH]c(=O)c2cc3ccnc(OC[C@@H]4CCC(=O)N4)c3cc12 |
| InChI | InChI=1S/C20H19N3O3/c1-2-3-13-10-22-19(25)17-8-12-6-7-21-20(16(12)9-15(13)17)26-11-14-4-5-18(24)23-14/h2,6-10,14H,1,3-5,11H2,(H,22,25)(H,23,24)/t14-/m0/s1 |
| InChIKey | KBRMWMHSYKCZKQ-AWEZNQCLSA-N |
| XLogP | 2.46 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|