C23H25N3O3 — CID 170244612
4-cyclopentyl-6-[2-[(2S)-5-oxopyrrolidin-2-yl]ethoxy]-2H-pyrido[3,4-g]isoquinolin-1-one (PubChem CID 170244612) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 4-cyclopentyl-6-[2-[(2S)-5-oxopyrrolidin-2-yl]ethoxy]-2H-pyrido[3,4-g]isoquinolin-1-one.
| Compound Name | 4-cyclopentyl-6-[2-[(2S)-5-oxopyrrolidin-2-yl]ethoxy]-2H-pyrido[3,4-g]isoquinolin-1-one |
|---|---|
| PubChem CID | 170244612 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 4-cyclopentyl-6-[2-[(2S)-5-oxopyrrolidin-2-yl]ethoxy]-2H-pyrido[3,4-g]isoquinolin-1-one |
| SMILES | O=C1CC[C@@H](CCOc2nccc3cc4c(=O)[nH]cc(C5CCCC5)c4cc23)N1 |
| InChI | InChI=1S/C23H25N3O3/c27-21-6-5-16(26-21)8-10-29-23-17-12-18-19(11-15(17)7-9-24-23)22(28)25-13-20(18)14-3-1-2-4-14/h7,9,11-14,16H,1-6,8,10H2,(H,25,28)(H,26,27)/t16-/m0/s1 |
| InChIKey | AHIMGXCHXHMIJV-INIZCTEOSA-N |
| XLogP | 3.78 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|