C15H13ClN4O2 — CID 140903686
1-[5-chloro-2-(oxolan-3-yloxy)pyrimidin-4-yl]benzimidazole (PubChem CID 140903686) has the molecular formula C15H13ClN4O2 and a molecular weight of 316.75 g/mol. Its IUPAC name is 1-[5-chloro-2-(oxolan-3-yloxy)pyrimidin-4-yl]benzimidazole.
| Compound Name | 1-[5-chloro-2-(oxolan-3-yloxy)pyrimidin-4-yl]benzimidazole |
|---|---|
| PubChem CID | 140903686 |
| Molecular Formula | C15H13ClN4O2 |
| Molecular Weight | 316.75 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 1-[5-chloro-2-(oxolan-3-yloxy)pyrimidin-4-yl]benzimidazole |
| SMILES | Clc1cnc(OC2CCOC2)nc1-n1cnc2ccccc21 |
| InChI | InChI=1S/C15H13ClN4O2/c16-11-7-17-15(22-10-5-6-21-8-10)19-14(11)20-9-18-12-3-1-2-4-13(12)20/h1-4,7,9-10H,5-6,8H2 |
| InChIKey | TUFFFNJZOVOSEH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.75 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |